C18H22F6N4O5S — CID 155828623
2-[[2-ethyl-7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155828623) has the molecular formula C18H22F6N4O5S and a molecular weight of 520.45 g/mol. Its IUPAC name is 2-[[2-ethyl-7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[[2-ethyl-7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155828623 |
| Molecular Formula | C18H22F6N4O5S |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | 2-[[2-ethyl-7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCn1cc2c(n1)C(COC)CN(Cc1nccs1)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20N4OS.2C2HF3O2/c1-3-18-8-11-6-17(9-13-15-4-5-20-13)7-12(10-19-2)14(11)16-18;2*3-2(4,5)1(6)7/h4-5,8,12H,3,6-7,9-10H2,1-2H3;2*(H,6,7) |
| InChIKey | VHBBOJDVECMLHP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |