C22H30FN3O3 — CID 131682125
(4aS,9aS)-2-(cyclopropylmethyl)-7-[2-(5-fluoro-2-pyridinyl)acetyl]-4-(methoxymethyl)-3,4,4a,5,6,8,9,9a-octahydropyrido[3,4-d]azepin-1-one (PubChem CID 131682125) has the molecular formula C22H30FN3O3 and a molecular weight of 403.50 g/mol. Its IUPAC name is (4aS,9aS)-2-(cyclopropylmethyl)-7-[2-(5-fluoro-2-pyridinyl)acetyl]-4-(methoxymethyl)-3,4,4a,5,6,8,9,9a-octahydropyrido[3,4-d]azepin-1-one.
| Compound Name | (4aS,9aS)-2-(cyclopropylmethyl)-7-[2-(5-fluoro-2-pyridinyl)acetyl]-4-(methoxymethyl)-3,4,4a,5,6,8,9,9a-octahydropyrido[3,4-d]azepin-1-one |
|---|---|
| PubChem CID | 131682125 |
| Molecular Formula | C22H30FN3O3 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (4aS,9aS)-2-(cyclopropylmethyl)-7-[2-(5-fluoro-2-pyridinyl)acetyl]-4-(methoxymethyl)-3,4,4a,5,6,8,9,9a-octahydropyrido[3,4-d]azepin-1-one |
| SMILES | COCC1CN(CC2CC2)C(=O)[C@H]2CCN(C(=O)Cc3ccc(F)cn3)CC[C@@H]12 |
| InChI | InChI=1S/C22H30FN3O3/c1-29-14-16-13-26(12-15-2-3-15)22(28)20-7-9-25(8-6-19(16)20)21(27)10-18-5-4-17(23)11-24-18/h4-5,11,15-16,19-20H,2-3,6-10,12-14H2,1H3/t16?,19-,20-/m0/s1 |
| InChIKey | ZJIAXXMBAFGYSS-RFFXKOPCSA-N |
| XLogP | 2.13 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |