C18H22FN3O4 — CID 131683056
1-[(2R,3aS,7aS)-2-(1,2-oxazolidine-2-carbonyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-2-(5-fluoro-2-pyridinyl)ethanone (PubChem CID 131683056) has the molecular formula C18H22FN3O4 and a molecular weight of 363.39 g/mol. Its IUPAC name is 1-[(2R,3aS,7aS)-2-(1,2-oxazolidine-2-carbonyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-2-(5-fluoro-2-pyridinyl)ethanone.
| Compound Name | 1-[(2R,3aS,7aS)-2-(1,2-oxazolidine-2-carbonyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-2-(5-fluoro-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 131683056 |
| Molecular Formula | C18H22FN3O4 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[(2R,3aS,7aS)-2-(1,2-oxazolidine-2-carbonyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-2-(5-fluoro-2-pyridinyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cn1)N1CC[C@H]2C[C@H](C(=O)N3CCCO3)O[C@@H]2C1 |
| InChI | InChI=1S/C18H22FN3O4/c19-13-2-3-14(20-10-13)9-17(23)21-6-4-12-8-15(26-16(12)11-21)18(24)22-5-1-7-25-22/h2-3,10,12,15-16H,1,4-9,11H2/t12-,15+,16+/m0/s1 |
| InChIKey | CPBNBMZVUJAAAZ-APHBMKBZSA-N |
| XLogP | 0.93 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |