C15H20N4O4S — CID 131683552
[(2S,3aS,7aS)-6-(thiadiazole-4-carbonyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(oxazinan-2-yl)methanone (PubChem CID 131683552) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is [(2S,3aS,7aS)-6-(thiadiazole-4-carbonyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(oxazinan-2-yl)methanone.
| Compound Name | [(2S,3aS,7aS)-6-(thiadiazole-4-carbonyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(oxazinan-2-yl)methanone |
|---|---|
| PubChem CID | 131683552 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [(2S,3aS,7aS)-6-(thiadiazole-4-carbonyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(oxazinan-2-yl)methanone |
| SMILES | O=C(c1csnn1)N1CC[C@H]2C[C@@H](C(=O)N3CCCCO3)O[C@@H]2C1 |
| InChI | InChI=1S/C15H20N4O4S/c20-14(11-9-24-17-16-11)18-5-3-10-7-12(23-13(10)8-18)15(21)19-4-1-2-6-22-19/h9-10,12-13H,1-8H2/t10-,12-,13+/m0/s1 |
| InChIKey | OBLZQAFMKKUGCD-WCFLWFBJSA-N |
| XLogP | 0.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |