C17H23FN4O2 — CID 131685304
(1-fluorocyclobutyl)-[7-[(pyrimidin-2-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone (PubChem CID 131685304) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is (1-fluorocyclobutyl)-[7-[(pyrimidin-2-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone.
| Compound Name | (1-fluorocyclobutyl)-[7-[(pyrimidin-2-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone |
|---|---|
| PubChem CID | 131685304 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (1-fluorocyclobutyl)-[7-[(pyrimidin-2-ylamino)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone |
| SMILES | O=C(N1CCOC2C(CNc3ncccn3)CCC21)C1(F)CCC1 |
| InChI | InChI=1S/C17H23FN4O2/c18-17(5-1-6-17)15(23)22-9-10-24-14-12(3-4-13(14)22)11-21-16-19-7-2-8-20-16/h2,7-8,12-14H,1,3-6,9-11H2,(H,19,20,21) |
| InChIKey | BAJOIHCRNVEFCD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |