C17H21N5O2 — CID 131685313
[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]-[3-(pyrrol-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methanone (PubChem CID 131685313) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is [(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]-[3-(pyrrol-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methanone.
| Compound Name | [(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]-[3-(pyrrol-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methanone |
|---|---|
| PubChem CID | 131685313 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | [(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]-[3-(pyrrol-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methanone |
| SMILES | O=C(C1[C@H]2COC[C@@H]12)N1CCCn2c(nnc2Cn2cccc2)C1 |
| InChI | InChI=1S/C17H21N5O2/c23-17(16-12-10-24-11-13(12)16)21-6-3-7-22-14(18-19-15(22)9-21)8-20-4-1-2-5-20/h1-2,4-5,12-13,16H,3,6-11H2/t12-,13+,16? |
| InChIKey | CXNBAMPDZIUSAX-OCZCAGDBSA-N |
| XLogP | 0.75 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |