C16H27N5O2 — CID 131697357
[3-[[methyl(propan-2-yl)amino]methyl]-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]-(oxolan-3-yl)methanone (PubChem CID 131697357) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is [3-[[methyl(propan-2-yl)amino]methyl]-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]-(oxolan-3-yl)methanone.
| Compound Name | [3-[[methyl(propan-2-yl)amino]methyl]-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]-(oxolan-3-yl)methanone |
|---|---|
| PubChem CID | 131697357 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | [3-[[methyl(propan-2-yl)amino]methyl]-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]-(oxolan-3-yl)methanone |
| SMILES | CC(C)N(C)Cc1nnc2n1CCCN(C(=O)C1CCOC1)C2 |
| InChI | InChI=1S/C16H27N5O2/c1-12(2)19(3)9-14-17-18-15-10-20(6-4-7-21(14)15)16(22)13-5-8-23-11-13/h12-13H,4-11H2,1-3H3 |
| InChIKey | SCSYWSMLTLZDHZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |