C21H29N3O2 — CID 131685942
N-[6-(4-methylcyclohexanecarbonyl)-6-azaspiro[3.4]octan-2-yl]pyridine-4-carboxamide (PubChem CID 131685942) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is N-[6-(4-methylcyclohexanecarbonyl)-6-azaspiro[3.4]octan-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[6-(4-methylcyclohexanecarbonyl)-6-azaspiro[3.4]octan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 131685942 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | N-[6-(4-methylcyclohexanecarbonyl)-6-azaspiro[3.4]octan-2-yl]pyridine-4-carboxamide |
| SMILES | CC1CCC(C(=O)N2CCC3(CC(NC(=O)c4ccncc4)C3)C2)CC1 |
| InChI | InChI=1S/C21H29N3O2/c1-15-2-4-17(5-3-15)20(26)24-11-8-21(14-24)12-18(13-21)23-19(25)16-6-9-22-10-7-16/h6-7,9-10,15,17-18H,2-5,8,11-14H2,1H3,(H,23,25) |
| InChIKey | RXMKMDNCDYTCGA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |