C17H23FN4O2 — CID 131685948
[3-[4-(cyclobutylamino)pyrimidin-2-yl]morpholin-4-yl]-(1-fluorocyclobutyl)methanone (PubChem CID 131685948) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is [3-[4-(cyclobutylamino)pyrimidin-2-yl]morpholin-4-yl]-(1-fluorocyclobutyl)methanone.
| Compound Name | [3-[4-(cyclobutylamino)pyrimidin-2-yl]morpholin-4-yl]-(1-fluorocyclobutyl)methanone |
|---|---|
| PubChem CID | 131685948 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [3-[4-(cyclobutylamino)pyrimidin-2-yl]morpholin-4-yl]-(1-fluorocyclobutyl)methanone |
| SMILES | O=C(N1CCOCC1c1nccc(NC2CCC2)n1)C1(F)CCC1 |
| InChI | InChI=1S/C17H23FN4O2/c18-17(6-2-7-17)16(23)22-9-10-24-11-13(22)15-19-8-5-14(21-15)20-12-3-1-4-12/h5,8,12-13H,1-4,6-7,9-11H2,(H,19,20,21) |
| InChIKey | UIKMVQGLMQXNEC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |