C15H25N5O2 — CID 53189344
N-(2-methoxyethyl)-2-[1-[2-(methylamino)pyrimidin-4-yl]piperidin-4-yl]acetamide (PubChem CID 53189344) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[1-[2-(methylamino)pyrimidin-4-yl]piperidin-4-yl]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[1-[2-(methylamino)pyrimidin-4-yl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 53189344 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-(2-methoxyethyl)-2-[1-[2-(methylamino)pyrimidin-4-yl]piperidin-4-yl]acetamide |
| SMILES | CNc1nccc(N2CCC(CC(=O)NCCOC)CC2)n1 |
| InChI | InChI=1S/C15H25N5O2/c1-16-15-18-6-3-13(19-15)20-8-4-12(5-9-20)11-14(21)17-7-10-22-2/h3,6,12H,4-5,7-11H2,1-2H3,(H,17,21)(H,16,18,19) |
| InChIKey | JBZCGPOWYRJOCU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|