C18H20N4O4 — CID 131686115
(3aR,6aS)-5-[(1R,5S)-3-oxabicyclo[3.1.0]hexane-6-carbonyl]-N-(pyridin-3-ylmethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide (PubChem CID 131686115) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is (3aR,6aS)-5-[(1R,5S)-3-oxabicyclo[3.1.0]hexane-6-carbonyl]-N-(pyridin-3-ylmethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide.
| Compound Name | (3aR,6aS)-5-[(1R,5S)-3-oxabicyclo[3.1.0]hexane-6-carbonyl]-N-(pyridin-3-ylmethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
|---|---|
| PubChem CID | 131686115 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (3aR,6aS)-5-[(1R,5S)-3-oxabicyclo[3.1.0]hexane-6-carbonyl]-N-(pyridin-3-ylmethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1=NO[C@@H]2CN(C(=O)C3[C@H]4COC[C@@H]34)C[C@H]12 |
| InChI | InChI=1S/C18H20N4O4/c23-17(20-5-10-2-1-3-19-4-10)16-11-6-22(7-14(11)26-21-16)18(24)15-12-8-25-9-13(12)15/h1-4,11-15H,5-9H2,(H,20,23)/t11-,12-,13+,14+,15?/m0/s1 |
| InChIKey | HRPISAIULQCQCK-UUWGUWTESA-N |
| XLogP | -0.20 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |