C17H22FN3O2 — CID 131686187
(1-fluorocyclobutyl)-[3-(pyridin-2-ylamino)-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone (PubChem CID 131686187) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is (1-fluorocyclobutyl)-[3-(pyridin-2-ylamino)-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone.
| Compound Name | (1-fluorocyclobutyl)-[3-(pyridin-2-ylamino)-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone |
|---|---|
| PubChem CID | 131686187 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (1-fluorocyclobutyl)-[3-(pyridin-2-ylamino)-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone |
| SMILES | O=C(N1CCC2(CC(Nc3ccccn3)CO2)C1)C1(F)CCC1 |
| InChI | InChI=1S/C17H22FN3O2/c18-17(5-3-6-17)15(22)21-9-7-16(12-21)10-13(11-23-16)20-14-4-1-2-8-19-14/h1-2,4,8,13H,3,5-7,9-12H2,(H,19,20) |
| InChIKey | LWTJHPUDAOAYHF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |