C17H22N4O2 — CID 97486398
cyclopent-3-en-1-yl-[(3S,5S)-3-(pyrazin-2-ylamino)-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone (PubChem CID 97486398) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[(3S,5S)-3-(pyrazin-2-ylamino)-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone.
| Compound Name | cyclopent-3-en-1-yl-[(3S,5S)-3-(pyrazin-2-ylamino)-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone |
|---|---|
| PubChem CID | 97486398 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | cyclopent-3-en-1-yl-[(3S,5S)-3-(pyrazin-2-ylamino)-1-oxa-7-azaspiro[4.4]nonan-7-yl]methanone |
| SMILES | O=C(C1CC=CC1)N1CC[C@]2(C[C@H](Nc3cnccn3)CO2)C1 |
| InChI | InChI=1S/C17H22N4O2/c22-16(13-3-1-2-4-13)21-8-5-17(12-21)9-14(11-23-17)20-15-10-18-6-7-19-15/h1-2,6-7,10,13-14H,3-5,8-9,11-12H2,(H,19,20)/t14-,17-/m0/s1 |
| InChIKey | FLGGFBXUYHILPA-YOEHRIQHSA-N |
| XLogP | 1.61 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|