C14H19N3O4 — CID 131686765
(3aR,6aS)-N-cyclopropyl-5-(3-hydroxycyclobutanecarbonyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide (PubChem CID 131686765) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is (3aR,6aS)-N-cyclopropyl-5-(3-hydroxycyclobutanecarbonyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide.
| Compound Name | (3aR,6aS)-N-cyclopropyl-5-(3-hydroxycyclobutanecarbonyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
|---|---|
| PubChem CID | 131686765 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (3aR,6aS)-N-cyclopropyl-5-(3-hydroxycyclobutanecarbonyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
| SMILES | O=C(NC1CC1)C1=NO[C@@H]2CN(C(=O)C3CC(O)C3)C[C@H]12 |
| InChI | InChI=1S/C14H19N3O4/c18-9-3-7(4-9)14(20)17-5-10-11(6-17)21-16-12(10)13(19)15-8-1-2-8/h7-11,18H,1-6H2,(H,15,19)/t7?,9?,10-,11+/m0/s1 |
| InChIKey | IYLKCOHONPUJNF-BHOWOBCZSA-N |
| XLogP | -0.75 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |