C13H17F2N3O3 — CID 131686836
(3aR,6aS)-5-(3,3-difluorocyclobutanecarbonyl)-N,N-dimethyl-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide (PubChem CID 131686836) has the molecular formula C13H17F2N3O3 and a molecular weight of 301.29 g/mol. Its IUPAC name is (3aR,6aS)-5-(3,3-difluorocyclobutanecarbonyl)-N,N-dimethyl-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide.
| Compound Name | (3aR,6aS)-5-(3,3-difluorocyclobutanecarbonyl)-N,N-dimethyl-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
|---|---|
| PubChem CID | 131686836 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (3aR,6aS)-5-(3,3-difluorocyclobutanecarbonyl)-N,N-dimethyl-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-3-carboxamide |
| SMILES | CN(C)C(=O)C1=NO[C@@H]2CN(C(=O)C3CC(F)(F)C3)C[C@H]12 |
| InChI | InChI=1S/C13H17F2N3O3/c1-17(2)12(20)10-8-5-18(6-9(8)21-16-10)11(19)7-3-13(14,15)4-7/h7-9H,3-6H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | QCJHWACOOUOKQF-DTWKUNHWSA-N |
| XLogP | 0.33 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |