C18H25N3O2 — CID 131688296
(5S,9S)-9-methyl-2-prop-2-enyl-7-[3-(1H-pyrrol-2-yl)propanoyl]-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 131688296) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (5S,9S)-9-methyl-2-prop-2-enyl-7-[3-(1H-pyrrol-2-yl)propanoyl]-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | (5S,9S)-9-methyl-2-prop-2-enyl-7-[3-(1H-pyrrol-2-yl)propanoyl]-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 131688296 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (5S,9S)-9-methyl-2-prop-2-enyl-7-[3-(1H-pyrrol-2-yl)propanoyl]-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | C=CCN1CC[C@]2(CN(C(=O)CCc3ccc[nH]3)C[C@H]2C)C1=O |
| InChI | InChI=1S/C18H25N3O2/c1-3-10-20-11-8-18(17(20)23)13-21(12-14(18)2)16(22)7-6-15-5-4-9-19-15/h3-5,9,14,19H,1,6-8,10-13H2,2H3/t14-,18-/m1/s1 |
| InChIKey | NXTJTJMIQVZTMA-RDTXWAMCSA-N |
| XLogP | 1.83 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|