C16H21N3O3 — CID 97392323
(5S,9S)-9-methyl-7-(5-methyl-1,2-oxazole-3-carbonyl)-2-prop-2-enyl-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 97392323) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is (5S,9S)-9-methyl-7-(5-methyl-1,2-oxazole-3-carbonyl)-2-prop-2-enyl-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | (5S,9S)-9-methyl-7-(5-methyl-1,2-oxazole-3-carbonyl)-2-prop-2-enyl-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 97392323 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (5S,9S)-9-methyl-7-(5-methyl-1,2-oxazole-3-carbonyl)-2-prop-2-enyl-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | C=CCN1CC[C@]2(CN(C(=O)c3cc(C)on3)C[C@H]2C)C1=O |
| InChI | InChI=1S/C16H21N3O3/c1-4-6-18-7-5-16(15(18)21)10-19(9-11(16)2)14(20)13-8-12(3)22-17-13/h4,8,11H,1,5-7,9-10H2,2-3H3/t11-,16-/m1/s1 |
| InChIKey | CEWIORQBOLGOSD-BDJLRTHQSA-N |
| XLogP | 1.48 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|