C19H21N3O2S2 — CID 131672750
7-(5-methylthiophene-2-carbonyl)-2-prop-2-enyl-9-(1,3-thiazol-2-yl)-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 131672750) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 7-(5-methylthiophene-2-carbonyl)-2-prop-2-enyl-9-(1,3-thiazol-2-yl)-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | 7-(5-methylthiophene-2-carbonyl)-2-prop-2-enyl-9-(1,3-thiazol-2-yl)-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 131672750 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 7-(5-methylthiophene-2-carbonyl)-2-prop-2-enyl-9-(1,3-thiazol-2-yl)-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | C=CCN1CCC2(CN(C(=O)c3ccc(C)s3)CC2c2nccs2)C1=O |
| InChI | InChI=1S/C19H21N3O2S2/c1-3-8-21-9-6-19(18(21)24)12-22(11-14(19)16-20-7-10-25-16)17(23)15-5-4-13(2)26-15/h3-5,7,10,14H,1,6,8-9,11-12H2,2H3 |
| InChIKey | AXZXYEPRTIVCHQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|