C18H21N3OS2 — CID 131670157
2-prop-2-enyl-9-(1,3-thiazol-2-yl)-7-(thiophen-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 131670157) has the molecular formula C18H21N3OS2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 2-prop-2-enyl-9-(1,3-thiazol-2-yl)-7-(thiophen-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | 2-prop-2-enyl-9-(1,3-thiazol-2-yl)-7-(thiophen-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 131670157 |
| Molecular Formula | C18H21N3OS2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-prop-2-enyl-9-(1,3-thiazol-2-yl)-7-(thiophen-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | C=CCN1CCC2(CN(Cc3cccs3)CC2c2nccs2)C1=O |
| InChI | InChI=1S/C18H21N3OS2/c1-2-7-21-8-5-18(17(21)22)13-20(11-14-4-3-9-23-14)12-15(18)16-19-6-10-24-16/h2-4,6,9-10,15H,1,5,7-8,11-13H2 |
| InChIKey | FFPVXQTWAWSAQA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|