C18H25N3O4 — CID 131688585
[(3S,3aR,7aS)-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(3-methoxy-4-pyridinyl)methanone (PubChem CID 131688585) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is [(3S,3aR,7aS)-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(3-methoxy-4-pyridinyl)methanone.
| Compound Name | [(3S,3aR,7aS)-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(3-methoxy-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 131688585 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | [(3S,3aR,7aS)-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(3-methoxy-4-pyridinyl)methanone |
| SMILES | COc1cnccc1C(=O)N1C[C@H](N2CCOCC2)[C@@H]2OCCC[C@@H]21 |
| InChI | InChI=1S/C18H25N3O4/c1-23-16-11-19-5-4-13(16)18(22)21-12-15(20-6-9-24-10-7-20)17-14(21)3-2-8-25-17/h4-5,11,14-15,17H,2-3,6-10,12H2,1H3/t14-,15-,17+/m0/s1 |
| InChIKey | MKMKWIPYOIZDQX-YQQAZPJKSA-N |
| XLogP | 0.79 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |