C18H28N2O5 — CID 131689747
(4R,4aR,8aR)-N-(2-methoxyethyl)-6-[(1S,5R)-3-oxabicyclo[3.1.0]hexane-6-carbonyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide (PubChem CID 131689747) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is (4R,4aR,8aR)-N-(2-methoxyethyl)-6-[(1S,5R)-3-oxabicyclo[3.1.0]hexane-6-carbonyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide.
| Compound Name | (4R,4aR,8aR)-N-(2-methoxyethyl)-6-[(1S,5R)-3-oxabicyclo[3.1.0]hexane-6-carbonyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 131689747 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (4R,4aR,8aR)-N-(2-methoxyethyl)-6-[(1S,5R)-3-oxabicyclo[3.1.0]hexane-6-carbonyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CCO[C@@H]2CCN(C(=O)C3[C@H]4COC[C@@H]34)C[C@H]21 |
| InChI | InChI=1S/C18H28N2O5/c1-23-7-4-19-17(21)11-3-6-25-15-2-5-20(8-12(11)15)18(22)16-13-9-24-10-14(13)16/h11-16H,2-10H2,1H3,(H,19,21)/t11-,12+,13-,14+,15-,16?/m1/s1 |
| InChIKey | PSPZSBVSYMASKE-WEZGTFFGSA-N |
| XLogP | -0.10 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|