C15H26N2O4 — CID 97388800
[(4R,4aS,8aR)-6-(2-methoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 97388800) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is [(4R,4aS,8aR)-6-(2-methoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | [(4R,4aS,8aR)-6-(2-methoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 97388800 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | [(4R,4aS,8aR)-6-(2-methoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | COCCN1CC[C@H]2OCC[C@@H](C(=O)N3CCCO3)[C@H]2C1 |
| InChI | InChI=1S/C15H26N2O4/c1-19-10-7-16-6-3-14-13(11-16)12(4-9-20-14)15(18)17-5-2-8-21-17/h12-14H,2-11H2,1H3/t12-,13-,14-/m1/s1 |
| InChIKey | OZBBGODAODERSY-MGPQQGTHSA-N |
| XLogP | 0.52 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |