C16H28N2O4 — CID 97367117
[(4R,4aR,8aR)-6-(2-ethoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 97367117) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(4R,4aR,8aR)-6-(2-ethoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | [(4R,4aR,8aR)-6-(2-ethoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 97367117 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | [(4R,4aR,8aR)-6-(2-ethoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | CCOCCN1CC[C@H]2OCC[C@@H](C(=O)N3CCCO3)[C@@H]2C1 |
| InChI | InChI=1S/C16H28N2O4/c1-2-20-11-8-17-7-4-15-14(12-17)13(5-10-21-15)16(19)18-6-3-9-22-18/h13-15H,2-12H2,1H3/t13-,14+,15-/m1/s1 |
| InChIKey | KGAOWZOLJGHHQP-QLFBSQMISA-N |
| XLogP | 0.91 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|