C21H34N2O3 — CID 131690520
4-(ethoxymethyl)-2-ethyl-8-(1-methylcyclohex-3-ene-1-carbonyl)-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 131690520) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 4-(ethoxymethyl)-2-ethyl-8-(1-methylcyclohex-3-ene-1-carbonyl)-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 4-(ethoxymethyl)-2-ethyl-8-(1-methylcyclohex-3-ene-1-carbonyl)-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 131690520 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 4-(ethoxymethyl)-2-ethyl-8-(1-methylcyclohex-3-ene-1-carbonyl)-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | CCOCC1C(=O)N(CC)CC12CCN(C(=O)C1(C)CC=CCC1)CC2 |
| InChI | InChI=1S/C21H34N2O3/c1-4-22-16-21(17(18(22)24)15-26-5-2)11-13-23(14-12-21)19(25)20(3)9-7-6-8-10-20/h6-7,17H,4-5,8-16H2,1-3H3 |
| InChIKey | SQDGKZCVTLIMQO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|