C22H26N2O3 — CID 131686124
4-[[(3S,3aS,6aS)-5-(1-methylcyclohex-3-ene-1-carbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methoxy]benzonitrile (PubChem CID 131686124) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-[[(3S,3aS,6aS)-5-(1-methylcyclohex-3-ene-1-carbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methoxy]benzonitrile.
| Compound Name | 4-[[(3S,3aS,6aS)-5-(1-methylcyclohex-3-ene-1-carbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 131686124 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-[[(3S,3aS,6aS)-5-(1-methylcyclohex-3-ene-1-carbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methoxy]benzonitrile |
| SMILES | CC1(C(=O)N2C[C@@H]3[C@H](COc4ccc(C#N)cc4)CO[C@@H]3C2)CC=CCC1 |
| InChI | InChI=1S/C22H26N2O3/c1-22(9-3-2-4-10-22)21(25)24-12-19-17(15-27-20(19)13-24)14-26-18-7-5-16(11-23)6-8-18/h2-3,5-8,17,19-20H,4,9-10,12-15H2,1H3/t17-,19-,20-,22?/m1/s1 |
| InChIKey | KGCLLFBXBMMVSU-JJDPIIQBSA-N |
| XLogP | 3.16 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|