C18H18N4O2 — CID 97483244
3-[[(3S,3aS,6aS)-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methoxy]benzonitrile (PubChem CID 97483244) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-[[(3S,3aS,6aS)-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methoxy]benzonitrile.
| Compound Name | 3-[[(3S,3aS,6aS)-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 97483244 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-[[(3S,3aS,6aS)-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methoxy]benzonitrile |
| SMILES | N#Cc1cccc(OC[C@@H]2CO[C@@H]3CN(c4ncccn4)C[C@H]23)c1 |
| InChI | InChI=1S/C18H18N4O2/c19-8-13-3-1-4-15(7-13)23-11-14-12-24-17-10-22(9-16(14)17)18-20-5-2-6-21-18/h1-7,14,16-17H,9-12H2/t14-,16-,17-/m1/s1 |
| InChIKey | AMSGYVLWZOHCLC-DJIMGWMZSA-N |
| XLogP | 1.88 |
| TPSA | 71.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |