C17H26N4O2 — CID 131694735
2-(cyclohexen-1-yl)-1-[3-(methoxymethyl)-8-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]ethanone (PubChem CID 131694735) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-[3-(methoxymethyl)-8-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]ethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1-[3-(methoxymethyl)-8-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 131694735 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-[3-(methoxymethyl)-8-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]ethanone |
| SMILES | COCc1nnc2n1CCN(C(=O)CC1=CCCCC1)C(C)C2 |
| InChI | InChI=1S/C17H26N4O2/c1-13-10-15-18-19-16(12-23-2)21(15)9-8-20(13)17(22)11-14-6-4-3-5-7-14/h6,13H,3-5,7-12H2,1-2H3 |
| InChIKey | TUBPQMOJVWGYOM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|