C20H32N6 — CID 131694748
5-[(2,5-dimethylpyrazol-3-yl)methyl]-6-[(4-methylpiperidin-1-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine (PubChem CID 131694748) has the molecular formula C20H32N6 and a molecular weight of 356.52 g/mol. Its IUPAC name is 5-[(2,5-dimethylpyrazol-3-yl)methyl]-6-[(4-methylpiperidin-1-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine.
| Compound Name | 5-[(2,5-dimethylpyrazol-3-yl)methyl]-6-[(4-methylpiperidin-1-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 131694748 |
| Molecular Formula | C20H32N6 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 5-[(2,5-dimethylpyrazol-3-yl)methyl]-6-[(4-methylpiperidin-1-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine |
| SMILES | Cc1cc(CN2Cc3ccnn3CCC2CN2CCC(C)CC2)n(C)n1 |
| InChI | InChI=1S/C20H32N6/c1-16-5-9-24(10-6-16)13-18-7-11-26-19(4-8-21-26)14-25(18)15-20-12-17(2)22-23(20)3/h4,8,12,16,18H,5-7,9-11,13-15H2,1-3H3 |
| InChIKey | KZUHBQAVQGPKGT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |