C11H18BrN3 — CID 80679515
3-bromo-1-[(2,5-dimethylpyrazol-3-yl)methyl]piperidine (PubChem CID 80679515) has the molecular formula C11H18BrN3 and a molecular weight of 272.19 g/mol. Its IUPAC name is 3-bromo-1-[(2,5-dimethylpyrazol-3-yl)methyl]piperidine.
| Compound Name | 3-bromo-1-[(2,5-dimethylpyrazol-3-yl)methyl]piperidine |
|---|---|
| PubChem CID | 80679515 |
| Molecular Formula | C11H18BrN3 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 3-bromo-1-[(2,5-dimethylpyrazol-3-yl)methyl]piperidine |
| SMILES | Cc1cc(CN2CCCC(Br)C2)n(C)n1 |
| InChI | InChI=1S/C11H18BrN3/c1-9-6-11(14(2)13-9)8-15-5-3-4-10(12)7-15/h6,10H,3-5,7-8H2,1-2H3 |
| InChIKey | IYGUKDAAHWNCHV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|