C16H17NO2 — CID 13169762
(3R,5R)-4-ethyl-3,5-diphenyl-1,2,4-dioxazolidine (PubChem CID 13169762) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (3R,5R)-4-ethyl-3,5-diphenyl-1,2,4-dioxazolidine.
| Compound Name | (3R,5R)-4-ethyl-3,5-diphenyl-1,2,4-dioxazolidine |
|---|---|
| PubChem CID | 13169762 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (3R,5R)-4-ethyl-3,5-diphenyl-1,2,4-dioxazolidine |
| SMILES | CCN1[C@@H](c2ccccc2)OO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c1-2-17-15(13-9-5-3-6-10-13)18-19-16(17)14-11-7-4-8-12-14/h3-12,15-16H,2H2,1H3/t15-,16-/m1/s1 |
| InChIKey | BJNAZZYMTNJYAR-HZPDHXFCSA-N |
| XLogP | 3.67 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|