C26H24FN5O — CID 131701861
(4-benzhydrylpiperazin-1-yl)-[5-(4-fluorophenyl)-2H-triazol-4-yl]methanone (PubChem CID 131701861) has the molecular formula C26H24FN5O and a molecular weight of 441.51 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[5-(4-fluorophenyl)-2H-triazol-4-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[5-(4-fluorophenyl)-2H-triazol-4-yl]methanone |
|---|---|
| PubChem CID | 131701861 |
| Molecular Formula | C26H24FN5O |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[5-(4-fluorophenyl)-2H-triazol-4-yl]methanone |
| SMILES | O=C(c1n[nH]nc1-c1ccc(F)cc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H24FN5O/c27-22-13-11-19(12-14-22)23-24(29-30-28-23)26(33)32-17-15-31(16-18-32)25(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-14,25H,15-18H2,(H,28,29,30) |
| InChIKey | MFZBXKDKHFXLRL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |