C27H25FN4O — CID 20953289
(4-benzhydrylpiperazin-1-yl)-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 20953289) has the molecular formula C27H25FN4O and a molecular weight of 440.52 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 20953289 |
| Molecular Formula | C27H25FN4O |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | O=C(c1cc(-c2ccc(F)cc2)n[nH]1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H25FN4O/c28-23-13-11-20(12-14-23)24-19-25(30-29-24)27(33)32-17-15-31(16-18-32)26(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-14,19,26H,15-18H2,(H,29,30) |
| InChIKey | FVRHPUJEYXRXNY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |