C20H18ClN4O5S+ — CID 131709474
3-[(3-chloro-4-methylthiophen-2-yl)methyl]-1-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylic acid (PubChem CID 131709474) has the molecular formula C20H18ClN4O5S+ and a molecular weight of 461.91 g/mol. Its IUPAC name is 3-[(3-chloro-4-methylthiophen-2-yl)methyl]-1-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylic acid.
| Compound Name | 3-[(3-chloro-4-methylthiophen-2-yl)methyl]-1-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 131709474 |
| Molecular Formula | C20H18ClN4O5S+ |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 3-[(3-chloro-4-methylthiophen-2-yl)methyl]-1-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxylic acid |
| SMILES | Cc1csc(CN2C(=O)C(C(=O)O)C=[N+](c3ccc4c(c3)n(C)c(=O)n4C)C2=O)c1Cl |
| InChI | InChI=1S/C20H17ClN4O5S/c1-10-9-31-15(16(10)21)8-25-17(26)12(18(27)28)7-24(20(25)30)11-4-5-13-14(6-11)23(3)19(29)22(13)2/h4-7,9,12H,8H2,1-3H3/p+1 |
| InChIKey | AUTSKVDZPNFTNQ-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|