C27H26F3N4O5+ — CID 131709515
ethyl 1-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,4-dioxo-3-[5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-5H-pyrimidin-1-ium-5-carboxylate (PubChem CID 131709515) has the molecular formula C27H26F3N4O5+ and a molecular weight of 543.52 g/mol. Its IUPAC name is ethyl 1-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,4-dioxo-3-[5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-5H-pyrimidin-1-ium-5-carboxylate.
| Compound Name | ethyl 1-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,4-dioxo-3-[5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-5H-pyrimidin-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 131709515 |
| Molecular Formula | C27H26F3N4O5+ |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | ethyl 1-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-2,4-dioxo-3-[5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-5H-pyrimidin-1-ium-5-carboxylate |
| SMILES | CCOC(=O)C1C=[N+](c2ccc3c(c2)n(C)c(=O)n3C)C(=O)N(C2CCCc3c2cccc3C(F)(F)F)C1=O |
| InChI | InChI=1S/C27H26F3N4O5/c1-4-39-24(36)18-14-33(15-11-12-21-22(13-15)32(3)25(37)31(21)2)26(38)34(23(18)35)20-10-6-7-16-17(20)8-5-9-19(16)27(28,29)30/h5,8-9,11-14,18,20H,4,6-7,10H2,1-3H3/q+1 |
| InChIKey | SRBVMHZGWDZNIC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 93.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|