C22H35FN6O2 — CID 131709779
6-fluoro-3-[6-[4-(2-methoxyethyl)piperazin-1-yl]pyrimidin-4-yl]-5-(1-methylcyclopropyl)oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole (PubChem CID 131709779) has the molecular formula C22H35FN6O2 and a molecular weight of 434.56 g/mol. Its IUPAC name is 6-fluoro-3-[6-[4-(2-methoxyethyl)piperazin-1-yl]pyrimidin-4-yl]-5-(1-methylcyclopropyl)oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole.
| Compound Name | 6-fluoro-3-[6-[4-(2-methoxyethyl)piperazin-1-yl]pyrimidin-4-yl]-5-(1-methylcyclopropyl)oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole |
|---|---|
| PubChem CID | 131709779 |
| Molecular Formula | C22H35FN6O2 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 6-fluoro-3-[6-[4-(2-methoxyethyl)piperazin-1-yl]pyrimidin-4-yl]-5-(1-methylcyclopropyl)oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole |
| SMILES | COCCN1CCN(c2cc(C3NNC4CC(F)C(OC5(C)CC5)CC43)ncn2)CC1 |
| InChI | InChI=1S/C22H35FN6O2/c1-22(3-4-22)31-19-11-15-17(12-16(19)23)26-27-21(15)18-13-20(25-14-24-18)29-7-5-28(6-8-29)9-10-30-2/h13-17,19,21,26-27H,3-12H2,1-2H3 |
| InChIKey | AGJFSLDLRFDDFY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |