C18H30N6O7 — CID 131710981
3-[[[(2S)-1-[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-methylamino]-2-hydroxy-2-methyl-3-oxopropanamide (PubChem CID 131710981) has the molecular formula C18H30N6O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is 3-[[[(2S)-1-[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-methylamino]-2-hydroxy-2-methyl-3-oxopropanamide.
| Compound Name | 3-[[[(2S)-1-[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-methylamino]-2-hydroxy-2-methyl-3-oxopropanamide |
|---|---|
| PubChem CID | 131710981 |
| Molecular Formula | C18H30N6O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 3-[[[(2S)-1-[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-methylamino]-2-hydroxy-2-methyl-3-oxopropanamide |
| SMILES | CC(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)NN(C)C(=O)C(C)(O)C(N)=O |
| InChI | InChI=1S/C18H30N6O7/c1-9(20-11(3)25)13(26)21-10(2)15(28)24-8-6-7-12(24)14(27)22-23(5)17(30)18(4,31)16(19)29/h9-10,12,31H,6-8H2,1-5H3,(H2,19,29)(H,20,25)(H,21,26)(H,22,27)/t9-,10-,12-,18?/m0/s1 |
| InChIKey | UUEQSWRZORPKSR-APGWKYEESA-N |
| XLogP | -3.27 |
| TPSA | 191.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|