C17H29N5O6 — CID 54346309
ethyl N-[[(2S)-1-[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-N-methylcarbamate (PubChem CID 54346309) has the molecular formula C17H29N5O6 and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl N-[[(2S)-1-[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-N-methylcarbamate.
| Compound Name | ethyl N-[[(2S)-1-[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-N-methylcarbamate |
|---|---|
| PubChem CID | 54346309 |
| Molecular Formula | C17H29N5O6 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | ethyl N-[[(2S)-1-[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C17H29N5O6/c1-6-28-17(27)21(5)20-15(25)13-8-7-9-22(13)16(26)11(3)19-14(24)10(2)18-12(4)23/h10-11,13H,6-9H2,1-5H3,(H,18,23)(H,19,24)(H,20,25)/t10-,11-,13-/m0/s1 |
| InChIKey | UCNUIADSJWLDDC-GVXVVHGQSA-N |
| XLogP | -0.87 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|