C16H29N5O4 — CID 46850017
(2S)-1-[(2S)-2-acetamidopropanoyl]-N-[(2S)-1-hydrazinyl-1-oxohexan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 46850017) has the molecular formula C16H29N5O4 and a molecular weight of 355.44 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-acetamidopropanoyl]-N-[(2S)-1-hydrazinyl-1-oxohexan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-acetamidopropanoyl]-N-[(2S)-1-hydrazinyl-1-oxohexan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 46850017 |
| Molecular Formula | C16H29N5O4 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | (2S)-1-[(2S)-2-acetamidopropanoyl]-N-[(2S)-1-hydrazinyl-1-oxohexan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(C)=O)C(=O)NN |
| InChI | InChI=1S/C16H29N5O4/c1-4-5-7-12(14(23)20-17)19-15(24)13-8-6-9-21(13)16(25)10(2)18-11(3)22/h10,12-13H,4-9,17H2,1-3H3,(H,18,22)(H,19,24)(H,20,23)/t10-,12-,13-/m0/s1 |
| InChIKey | YLJWZWOVFLHWGN-DRZSPHRISA-N |
| XLogP | -0.83 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|