C9H17N3S — CID 131712935
2-(piperazin-1-ylmethyl)-3,4-dihydro-2H-1,3-thiazine (PubChem CID 131712935) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is 2-(piperazin-1-ylmethyl)-3,4-dihydro-2H-1,3-thiazine.
| Compound Name | 2-(piperazin-1-ylmethyl)-3,4-dihydro-2H-1,3-thiazine |
|---|---|
| PubChem CID | 131712935 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-(piperazin-1-ylmethyl)-3,4-dihydro-2H-1,3-thiazine |
| SMILES | C1=CSC(CN2CCNCC2)NC1 |
| InChI | InChI=1S/C9H17N3S/c1-2-11-9(13-7-1)8-12-5-3-10-4-6-12/h1,7,9-11H,2-6,8H2 |
| InChIKey | YYVQRFMNMTVGRM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |