C22H23ClN2O2S2 — CID 131713539
O-benzhydryl (6R)-7-amino-3-ethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate;hydrochloride (PubChem CID 131713539) has the molecular formula C22H23ClN2O2S2 and a molecular weight of 447.03 g/mol. Its IUPAC name is O-benzhydryl (6R)-7-amino-3-ethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate;hydrochloride.
| Compound Name | O-benzhydryl (6R)-7-amino-3-ethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate;hydrochloride |
|---|---|
| PubChem CID | 131713539 |
| Molecular Formula | C22H23ClN2O2S2 |
| Molecular Weight | 447.03 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | O-benzhydryl (6R)-7-amino-3-ethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate;hydrochloride |
| SMILES | CCC1=C(C(=S)OC(c2ccccc2)c2ccccc2)N2C(=O)C(N)[C@H]2SC1.Cl |
| InChI | InChI=1S/C22H22N2O2S2.ClH/c1-2-14-13-28-21-17(23)20(25)24(21)18(14)22(27)26-19(15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12,17,19,21H,2,13,23H2,1H3;1H/t17?,21-;/m1./s1 |
| InChIKey | HIGIHBUNBHWMSL-ACGHUIMASA-N |
| XLogP | 4.45 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.03 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|