C16H31N5O5 — CID 131713868
tert-butyl N-[[(2S)-5-amino-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-5-oxopentanoyl]amino]carbamate (PubChem CID 131713868) has the molecular formula C16H31N5O5 and a molecular weight of 373.45 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-5-amino-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-5-oxopentanoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2S)-5-amino-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-5-oxopentanoyl]amino]carbamate |
|---|---|
| PubChem CID | 131713868 |
| Molecular Formula | C16H31N5O5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | tert-butyl N-[[(2S)-5-amino-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-5-oxopentanoyl]amino]carbamate |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31N5O5/c1-9(2)8-10(17)13(23)19-11(6-7-12(18)22)14(24)20-21-15(25)26-16(3,4)5/h9-11H,6-8,17H2,1-5H3,(H2,18,22)(H,19,23)(H,20,24)(H,21,25)/t10-,11-/m0/s1 |
| InChIKey | ZFGWCCRWWLZEEN-QWRGUYRKSA-N |
| XLogP | -0.33 |
| TPSA | 165.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|