C17H36N6O4 — CID 139252847
tert-butyl N-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]carbamate (PubChem CID 139252847) has the molecular formula C17H36N6O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]carbamate |
|---|---|
| PubChem CID | 139252847 |
| Molecular Formula | C17H36N6O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | tert-butyl N-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C17H36N6O4/c1-17(2,3)27-16(26)23-22-15(25)13(9-5-7-11-19)21-14(24)12(20)8-4-6-10-18/h12-13H,4-11,18-20H2,1-3H3,(H,21,24)(H,22,25)(H,23,26)/t12-,13-/m0/s1 |
| InChIKey | CODLNAOPVYJPIX-STQMWFEESA-N |
| XLogP | -0.39 |
| TPSA | 174.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|