C18H11N3O2S — CID 13171496
2-(1,3-benzodioxol-5-yl)-5-quinolin-4-yl-1,3,4-thiadiazole (PubChem CID 13171496) has the molecular formula C18H11N3O2S and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-quinolin-4-yl-1,3,4-thiadiazole.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-quinolin-4-yl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 13171496 |
| Molecular Formula | C18H11N3O2S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-quinolin-4-yl-1,3,4-thiadiazole |
| SMILES | c1ccc2c(-c3nnc(-c4ccc5c(c4)OCO5)s3)ccnc2c1 |
| InChI | InChI=1S/C18H11N3O2S/c1-2-4-14-12(3-1)13(7-8-19-14)18-21-20-17(24-18)11-5-6-15-16(9-11)23-10-22-15/h1-9H,10H2 |
| InChIKey | UUSJNSVXGFWTCN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |