C18H23O6- — CID 131715180
4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-oxo-6-phenylhexanoate (PubChem CID 131715180) has the molecular formula C18H23O6- and a molecular weight of 335.38 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-oxo-6-phenylhexanoate.
| Compound Name | 4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-oxo-6-phenylhexanoate |
|---|---|
| PubChem CID | 131715180 |
| Molecular Formula | C18H23O6- |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-oxo-6-phenylhexanoate |
| SMILES | CC1(C)OCC(COC(CCc2ccccc2)C(=O)CC(=O)[O-])O1 |
| InChI | InChI=1S/C18H24O6/c1-18(2)23-12-14(24-18)11-22-16(15(19)10-17(20)21)9-8-13-6-4-3-5-7-13/h3-7,14,16H,8-12H2,1-2H3,(H,20,21)/p-1 |
| InChIKey | DCBPEEQUQQKCQV-UHFFFAOYSA-M |
| XLogP | 0.87 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|