C23H28ClN3O6 — CID 131715564
[(3S,4R)-1-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)-6-nitro-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl] acetate;hydrochloride (PubChem CID 131715564) has the molecular formula C23H28ClN3O6 and a molecular weight of 477.95 g/mol. Its IUPAC name is [(3S,4R)-1-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)-6-nitro-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl] acetate;hydrochloride.
| Compound Name | [(3S,4R)-1-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)-6-nitro-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl] acetate;hydrochloride |
|---|---|
| PubChem CID | 131715564 |
| Molecular Formula | C23H28ClN3O6 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [(3S,4R)-1-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)-6-nitro-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl] acetate;hydrochloride |
| SMILES | COc1ccc([C@H]2Cc3c(cccc3[N+](=O)[O-])N(CCN(C)C)C(=O)[C@H]2OC(C)=O)cc1.Cl |
| InChI | InChI=1S/C23H27N3O6.ClH/c1-15(27)32-22-18(16-8-10-17(31-4)11-9-16)14-19-20(6-5-7-21(19)26(29)30)25(23(22)28)13-12-24(2)3;/h5-11,18,22H,12-14H2,1-4H3;1H/t18-,22+;/m1./s1 |
| InChIKey | INFQTGZNVNGWHT-MYXGOWFTSA-N |
| XLogP | 3.19 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|