C21H26ClN3O5 — CID 131715565
(3S,4R)-1-[2-(dimethylamino)ethyl]-3-hydroxy-4-(4-methoxyphenyl)-6-nitro-4,5-dihydro-3H-1-benzazepin-2-one;hydrochloride (PubChem CID 131715565) has the molecular formula C21H26ClN3O5 and a molecular weight of 435.91 g/mol. Its IUPAC name is (3S,4R)-1-[2-(dimethylamino)ethyl]-3-hydroxy-4-(4-methoxyphenyl)-6-nitro-4,5-dihydro-3H-1-benzazepin-2-one;hydrochloride.
| Compound Name | (3S,4R)-1-[2-(dimethylamino)ethyl]-3-hydroxy-4-(4-methoxyphenyl)-6-nitro-4,5-dihydro-3H-1-benzazepin-2-one;hydrochloride |
|---|---|
| PubChem CID | 131715565 |
| Molecular Formula | C21H26ClN3O5 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (3S,4R)-1-[2-(dimethylamino)ethyl]-3-hydroxy-4-(4-methoxyphenyl)-6-nitro-4,5-dihydro-3H-1-benzazepin-2-one;hydrochloride |
| SMILES | COc1ccc([C@H]2Cc3c(cccc3[N+](=O)[O-])N(CCN(C)C)C(=O)[C@H]2O)cc1.Cl |
| InChI | InChI=1S/C21H25N3O5.ClH/c1-22(2)11-12-23-18-5-4-6-19(24(27)28)17(18)13-16(20(25)21(23)26)14-7-9-15(29-3)10-8-14;/h4-10,16,20,25H,11-13H2,1-3H3;1H/t16-,20+;/m1./s1 |
| InChIKey | SBYMNGAVROJNAM-PXPMWPIZSA-N |
| XLogP | 2.62 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|