C13H26NO4+ — CID 131715697
[4-(carboxymethyl)-4-hydroxy-2,2-dimethyl-5-oxohexan-3-yl]-trimethylazanium (PubChem CID 131715697) has the molecular formula C13H26NO4+ and a molecular weight of 260.35 g/mol. Its IUPAC name is [4-(carboxymethyl)-4-hydroxy-2,2-dimethyl-5-oxohexan-3-yl]-trimethylazanium.
| Compound Name | [4-(carboxymethyl)-4-hydroxy-2,2-dimethyl-5-oxohexan-3-yl]-trimethylazanium |
|---|---|
| PubChem CID | 131715697 |
| Molecular Formula | C13H26NO4+ |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | [4-(carboxymethyl)-4-hydroxy-2,2-dimethyl-5-oxohexan-3-yl]-trimethylazanium |
| SMILES | CC(=O)C(O)(CC(=O)O)C(C(C)(C)C)[N+](C)(C)C |
| InChI | InChI=1S/C13H25NO4/c1-9(15)13(18,8-10(16)17)11(12(2,3)4)14(5,6)7/h11,18H,8H2,1-7H3/p+1 |
| InChIKey | VLZVBCKSEJHJKG-UHFFFAOYSA-O |
| XLogP | 0.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|