C11H22NO5+ — CID 140592473
[(2R)-2-(carboxymethyl)-1,2-dihydroxy-3-oxohexyl]-trimethylazanium (PubChem CID 140592473) has the molecular formula C11H22NO5+ and a molecular weight of 248.30 g/mol. Its IUPAC name is [(2R)-2-(carboxymethyl)-1,2-dihydroxy-3-oxohexyl]-trimethylazanium.
| Compound Name | [(2R)-2-(carboxymethyl)-1,2-dihydroxy-3-oxohexyl]-trimethylazanium |
|---|---|
| PubChem CID | 140592473 |
| Molecular Formula | C11H22NO5+ |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | [(2R)-2-(carboxymethyl)-1,2-dihydroxy-3-oxohexyl]-trimethylazanium |
| SMILES | CCCC(=O)[C@@](O)(CC(=O)O)C(O)[N+](C)(C)C |
| InChI | InChI=1S/C11H21NO5/c1-5-6-8(13)11(17,7-9(14)15)10(16)12(2,3)4/h10,16-17H,5-7H2,1-4H3/p+1/t10?,11-/m0/s1 |
| InChIKey | ICRROJBGINEFOZ-DTIOYNMSSA-O |
| XLogP | -0.41 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|