C12H22O3 — CID 173314036
3-oxo-2,2-di(propan-2-yl)hexanoic acid (PubChem CID 173314036) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 3-oxo-2,2-di(propan-2-yl)hexanoic acid.
| Compound Name | 3-oxo-2,2-di(propan-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 173314036 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 3-oxo-2,2-di(propan-2-yl)hexanoic acid |
| SMILES | CCCC(=O)C(C(=O)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C12H22O3/c1-6-7-10(13)12(8(2)3,9(4)5)11(14)15/h8-9H,6-7H2,1-5H3,(H,14,15) |
| InChIKey | XCNOXHAESZMAIA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|