C16H26O8 — CID 174261681
4-ethyl-2,7-dimethyloctane-2,2,5,5-tetracarboxylic acid (PubChem CID 174261681) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-ethyl-2,7-dimethyloctane-2,2,5,5-tetracarboxylic acid.
| Compound Name | 4-ethyl-2,7-dimethyloctane-2,2,5,5-tetracarboxylic acid |
|---|---|
| PubChem CID | 174261681 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-ethyl-2,7-dimethyloctane-2,2,5,5-tetracarboxylic acid |
| SMILES | CCC(CC(C(=O)O)(C(=O)O)C(C)C)C(C(=O)O)(C(=O)O)C(C)C |
| InChI | InChI=1S/C16H26O8/c1-6-10(16(9(4)5,13(21)22)14(23)24)7-15(8(2)3,11(17)18)12(19)20/h8-10H,6-7H2,1-5H3,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | DVKCDSWSEBWDJN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|